About 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate
4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122482275) has the molecular formula C11H13NO7
and a molecular weight of 271.23 g/mol. Its IUPAC name is 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
| PubChem CID | 122482275 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC1CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C11H13NO7/c1-18-9(15)2-3-10(16)19-7-6-8(14)12(4-5-13)11(7)17/h2-3,7,13H,4-6H2,1H3/b3-2+ |
| InChIKey | IEFVZRSEXVQUGT-NSCUHMNNSA-N |
| XLogP | -1.62 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate?
The IUPAC name of 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate (CID 122482275) is 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate.
What is the SMILES notation for 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate?
The canonical SMILES for 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate is COC(=O)/C=C/C(=O)OC1CC(=O)N(CCO)C1=O.
What is the InChIKey of 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate?
The InChIKey is IEFVZRSEXVQUGT-NSCUHMNNSA-N. The full InChI is InChI=1S/C11H13NO7/c1-18-9(15)2-3-10(16)19-7-6-8(14)12(4-5-13)11(7)17/h2-3,7,13H,4-6H2,1H3/b3-2+.
What are the key properties of 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate?
4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate has a molecular weight of 271.23 g/mol, XLogP of -1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate is sourced from PubChem (CID 122482275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).