C21H21F2N3O4 — CID 122482629
[(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methanol (PubChem CID 122482629) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methanol.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 122482629 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methanol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2ccc(F)c(F)c2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H21F2N3O4/c1-10-12-6-7-26(19(12)25-9-24-10)20-18-17(29-21(2,3)30-18)16(28-20)15(27)11-4-5-13(22)14(23)8-11/h4-9,15-18,20,27H,1-3H3/t15?,16-,17-,18-,20-/m1/s1 |
| InChIKey | VTFIGJLDABKDNM-SCWSVTQASA-N |
| XLogP | 3.17 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |