C29H24F2N4O5 — CID 122482668
2-[(S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methyl]isoindole-1,3-dione (PubChem CID 122482668) has the molecular formula C29H24F2N4O5 and a molecular weight of 546.53 g/mol. Its IUPAC name is 2-[(S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122482668 |
| Molecular Formula | C29H24F2N4O5 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 2-[(S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(3,4-difluorophenyl)methyl]isoindole-1,3-dione |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@H](c2ccc(F)c(F)c2)N2C(=O)c3ccccc3C2=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C29H24F2N4O5/c1-14-16-10-11-34(25(16)33-13-32-14)28-24-23(39-29(2,3)40-24)22(38-28)21(15-8-9-19(30)20(31)12-15)35-26(36)17-6-4-5-7-18(17)27(35)37/h4-13,21-24,28H,1-3H3/t21-,22+,23+,24+,28+/m0/s1 |
| InChIKey | JSCZHIYLUJDLFJ-WEQGDAHASA-N |
| XLogP | 4.47 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|