C17H15F3N4O4 — CID 122482730
(2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(3,4-difluorophenyl)-hydroxymethyl]oxolane-3,4-diol (PubChem CID 122482730) has the molecular formula C17H15F3N4O4 and a molecular weight of 396.33 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(3,4-difluorophenyl)-hydroxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(3,4-difluorophenyl)-hydroxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 122482730 |
| Molecular Formula | C17H15F3N4O4 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(3,4-difluorophenyl)-hydroxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1c(F)cn2[C@@H]1O[C@H]([C@H](O)c2ccc(F)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H15F3N4O4/c18-7-2-1-6(3-8(7)19)11(25)14-12(26)13(27)17(28-14)24-4-9(20)10-15(21)22-5-23-16(10)24/h1-5,11-14,17,25-27H,(H2,21,22,23)/t11-,12+,13-,14-,17-/m1/s1 |
| InChIKey | NYDWXLPQKNNOER-QFRSUPTLSA-N |
| XLogP | 0.78 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |