C18H18ClFN4O4 — CID 122482742
(2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(4-chloro-3-fluorophenyl)-1-hydroxyethyl]oxolane-3,4-diol (PubChem CID 122482742) has the molecular formula C18H18ClFN4O4 and a molecular weight of 408.82 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(4-chloro-3-fluorophenyl)-1-hydroxyethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(4-chloro-3-fluorophenyl)-1-hydroxyethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 122482742 |
| Molecular Formula | C18H18ClFN4O4 |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(4-chloro-3-fluorophenyl)-1-hydroxyethyl]oxolane-3,4-diol |
| SMILES | C[C@](O)(c1ccc(Cl)c(F)c1)[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18ClFN4O4/c1-18(27,8-2-3-10(19)11(20)6-8)14-12(25)13(26)17(28-14)24-5-4-9-15(21)22-7-23-16(9)24/h2-7,12-14,17,25-27H,1H3,(H2,21,22,23)/t12-,13+,14-,17+,18-/m0/s1 |
| InChIKey | CNXUOUWMMYLCGP-ASJPCPMZSA-N |
| XLogP | 1.33 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |