C20H19ClFN3O4 — CID 122482802
(S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-pyrrolo[2,3-d]pyrimidin-7-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chloro-3-fluorophenyl)methanol (PubChem CID 122482802) has the molecular formula C20H19ClFN3O4 and a molecular weight of 419.84 g/mol. Its IUPAC name is (S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-pyrrolo[2,3-d]pyrimidin-7-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chloro-3-fluorophenyl)methanol.
| Compound Name | (S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-pyrrolo[2,3-d]pyrimidin-7-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chloro-3-fluorophenyl)methanol |
|---|---|
| PubChem CID | 122482802 |
| Molecular Formula | C20H19ClFN3O4 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (S)-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-pyrrolo[2,3-d]pyrimidin-7-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chloro-3-fluorophenyl)methanol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@H](n1ccc3cncnc31)O[C@@H]2[C@@H](O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H19ClFN3O4/c1-20(2)28-16-15(14(26)10-3-4-12(21)13(22)7-10)27-19(17(16)29-20)25-6-5-11-8-23-9-24-18(11)25/h3-9,14-17,19,26H,1-2H3/t14-,15+,16+,17+,19+/m0/s1 |
| InChIKey | WNOZMDUNAZZZBU-SEFVSHJNSA-N |
| XLogP | 3.37 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |