About N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide
N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide (PubChem CID 122483008) has the molecular formula C10H8F5N3OS
and a molecular weight of 313.25 g/mol. Its IUPAC name is N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide.
Molecular Properties
| Compound Name | N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide |
| PubChem CID | 122483008 |
| Molecular Formula | C10H8F5N3OS |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide |
| SMILES | O=C(Nc1ccc(S(F)(F)(F)(F)F)cc1)n1cccn1 |
| InChI | InChI=1S/C10H8F5N3OS/c11-20(12,13,14,15)9-4-2-8(3-5-9)17-10(19)18-7-1-6-16-18/h1-7H,(H,17,19) |
| InChIKey | JPJMOKCQOIGOAP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide?
The IUPAC name of N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide (CID 122483008) is N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide.
What is the SMILES notation for N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide?
The canonical SMILES for N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide is O=C(Nc1ccc(S(F)(F)(F)(F)F)cc1)n1cccn1.
What is the InChIKey of N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide?
The InChIKey is JPJMOKCQOIGOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F5N3OS/c11-20(12,13,14,15)9-4-2-8(3-5-9)17-10(19)18-7-1-6-16-18/h1-7H,(H,17,19).
What are the key properties of N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide?
N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide has a molecular weight of 313.25 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazole-1-carboxamide is sourced from PubChem (CID 122483008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).