C24H32N8O2S — CID 122483325
N-[4-[[2-[[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 122483325) has the molecular formula C24H32N8O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is N-[4-[[2-[[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[[2-[[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 122483325 |
| Molecular Formula | C24H32N8O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-[4-[[2-[[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(Nc2nc(Nc3cnn(CCN4CCOCC4)c3)nc3ccsc23)CC1 |
| InChI | InChI=1S/C24H32N8O2S/c1-2-21(33)26-17-3-5-18(6-4-17)27-23-22-20(7-14-35-22)29-24(30-23)28-19-15-25-32(16-19)9-8-31-10-12-34-13-11-31/h2,7,14-18H,1,3-6,8-13H2,(H,26,33)(H2,27,28,29,30) |
| InChIKey | JVGXVDOYSMXLJT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|