C12H14F3N3S — CID 122483328
5-[(Z,3Z)-7,7,7-trifluoro-3-prop-2-enylidenehept-4-enyl]-1,3,4-thiadiazol-2-amine (PubChem CID 122483328) has the molecular formula C12H14F3N3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-[(Z,3Z)-7,7,7-trifluoro-3-prop-2-enylidenehept-4-enyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(Z,3Z)-7,7,7-trifluoro-3-prop-2-enylidenehept-4-enyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 122483328 |
| Molecular Formula | C12H14F3N3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-[(Z,3Z)-7,7,7-trifluoro-3-prop-2-enylidenehept-4-enyl]-1,3,4-thiadiazol-2-amine |
| SMILES | C=C/C=C(\C=C/CC(F)(F)F)CCc1nnc(N)s1 |
| InChI | InChI=1S/C12H14F3N3S/c1-2-4-9(5-3-8-12(13,14)15)6-7-10-17-18-11(16)19-10/h2-5H,1,6-8H2,(H2,16,18)/b5-3-,9-4+ |
| InChIKey | JCODUPSSFJMZLF-LWUTYWFWSA-N |
| XLogP | 3.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|