About 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene
1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene (PubChem CID 122483401) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene.
Molecular Properties
| Compound Name | 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene |
| PubChem CID | 122483401 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene |
| SMILES | C=Cc1cccc(CC)c1.C=Cc1ccccc1OC |
| InChI | InChI=1S/C10H12.C9H10O/c1-3-9-6-5-7-10(4-2)8-9;1-3-8-6-4-5-7-9(8)10-2/h3,5-8H,1,4H2,2H3;3-7H,1H2,2H3 |
| InChIKey | KKAIJBAIOSNHBV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene?
The IUPAC name of 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene (CID 122483401) is 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene.
What is the SMILES notation for 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene?
The canonical SMILES for 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene is C=Cc1cccc(CC)c1.C=Cc1ccccc1OC.
What is the InChIKey of 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene?
The InChIKey is KKAIJBAIOSNHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C9H10O/c1-3-9-6-5-7-10(4-2)8-9;1-3-8-6-4-5-7-9(8)10-2/h3,5-8H,1,4H2,2H3;3-7H,1H2,2H3.
What are the key properties of 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene?
1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene has a molecular weight of 266.38 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-ethylbenzene;1-ethenyl-2-methoxybenzene is sourced from PubChem (CID 122483401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).