About N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline
N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline (PubChem CID 122484936) has the molecular formula C28H33N
and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline |
| PubChem CID | 122484936 |
| Molecular Formula | C28H33N |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline |
| SMILES | CCC(C)(Nc1ccc(C)cc1C)c1ccc(C=Cc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C28H33N/c1-7-28(6,29-27-18-11-20(2)19-22(27)4)26-16-13-24(14-17-26)12-15-25-10-8-9-21(3)23(25)5/h8-19,29H,7H2,1-6H3 |
| InChIKey | ZQGCHDCHTNNNOV-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline?
The IUPAC name of N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline (CID 122484936) is N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline.
What is the SMILES notation for N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline?
The canonical SMILES for N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline is CCC(C)(Nc1ccc(C)cc1C)c1ccc(C=Cc2cccc(C)c2C)cc1.
What is the InChIKey of N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline?
The InChIKey is ZQGCHDCHTNNNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33N/c1-7-28(6,29-27-18-11-20(2)19-22(27)4)26-16-13-24(14-17-26)12-15-25-10-8-9-21(3)23(25)5/h8-19,29H,7H2,1-6H3.
What are the key properties of N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline?
N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline has a molecular weight of 383.58 g/mol, XLogP of 7.83, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-[2-(2,3-dimethylphenyl)ethenyl]phenyl]butan-2-yl]-2,4-dimethylaniline is sourced from PubChem (CID 122484936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).