About N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline
N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline (PubChem CID 122484984) has the molecular formula C27H31N
and a molecular weight of 369.55 g/mol. Its IUPAC name is N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline.
Molecular Properties
| Compound Name | N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline |
| PubChem CID | 122484984 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline |
| SMILES | CCC(CC)(Nc1ccccc1)c1ccc(C=Cc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C27H31N/c1-5-27(6-2,28-26-10-8-7-9-11-26)25-16-14-23(15-17-25)12-13-24-19-21(3)18-22(4)20-24/h7-20,28H,5-6H2,1-4H3 |
| InChIKey | XFFMZLRXEMUJDA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline?
The IUPAC name of N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline (CID 122484984) is N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline.
What is the SMILES notation for N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline?
The canonical SMILES for N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline is CCC(CC)(Nc1ccccc1)c1ccc(C=Cc2cc(C)cc(C)c2)cc1.
What is the InChIKey of N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline?
The InChIKey is XFFMZLRXEMUJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N/c1-5-27(6-2,28-26-10-8-7-9-11-26)25-16-14-23(15-17-25)12-13-24-19-21(3)18-22(4)20-24/h7-20,28H,5-6H2,1-4H3.
What are the key properties of N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline?
N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline has a molecular weight of 369.55 g/mol, XLogP of 7.60, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-[2-(3,5-dimethylphenyl)ethenyl]phenyl]pentan-3-yl]aniline is sourced from PubChem (CID 122484984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).