C22H20N6O2 — CID 122485358
2-amino-8-methoxy-N-[[6-(pyridin-3-ylmethyl)-2-pyridinyl]methyl]quinazoline-4-carboxamide (PubChem CID 122485358) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-amino-8-methoxy-N-[[6-(pyridin-3-ylmethyl)-2-pyridinyl]methyl]quinazoline-4-carboxamide.
| Compound Name | 2-amino-8-methoxy-N-[[6-(pyridin-3-ylmethyl)-2-pyridinyl]methyl]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 122485358 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-amino-8-methoxy-N-[[6-(pyridin-3-ylmethyl)-2-pyridinyl]methyl]quinazoline-4-carboxamide |
| SMILES | COc1cccc2c(C(=O)NCc3cccc(Cc4cccnc4)n3)nc(N)nc12 |
| InChI | InChI=1S/C22H20N6O2/c1-30-18-9-3-8-17-19(18)27-22(23)28-20(17)21(29)25-13-16-7-2-6-15(26-16)11-14-5-4-10-24-12-14/h2-10,12H,11,13H2,1H3,(H,25,29)(H2,23,27,28) |
| InChIKey | PRBWHEZLZLJYIT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |