C23H45N — CID 122485487
1-methyl-3-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine (PubChem CID 122485487) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is 1-methyl-3-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine.
| Compound Name | 1-methyl-3-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine |
|---|---|
| PubChem CID | 122485487 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | 1-methyl-3-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine |
| SMILES | C=C(CC1CCN(C)C1)CC(C)(C)C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45N/c1-18(14-19-12-13-24(11)16-19)15-21(5,6)23(9,10)17-22(7,8)20(2,3)4/h19H,1,12-17H2,2-11H3 |
| InChIKey | MROUHOIDFCPZOV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|