C27H21N3S5 — CID 122485902
(2E)-3-imino-2-[(2E)-2-[(5Z)-5-(3,4,5,6,7-pentamethyl-1,3-benzothiazol-2-ylidene)thieno[3,2-b]thiophen-2-ylidene]thieno[3,2-b]thiophen-5-ylidene]propanenitrile (PubChem CID 122485902) has the molecular formula C27H21N3S5 and a molecular weight of 547.82 g/mol. Its IUPAC name is (2E)-3-imino-2-[(2E)-2-[(5Z)-5-(3,4,5,6,7-pentamethyl-1,3-benzothiazol-2-ylidene)thieno[3,2-b]thiophen-2-ylidene]thieno[3,2-b]thiophen-5-ylidene]propanenitrile.
| Compound Name | (2E)-3-imino-2-[(2E)-2-[(5Z)-5-(3,4,5,6,7-pentamethyl-1,3-benzothiazol-2-ylidene)thieno[3,2-b]thiophen-2-ylidene]thieno[3,2-b]thiophen-5-ylidene]propanenitrile |
|---|---|
| PubChem CID | 122485902 |
| Molecular Formula | C27H21N3S5 |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | (2E)-3-imino-2-[(2E)-2-[(5Z)-5-(3,4,5,6,7-pentamethyl-1,3-benzothiazol-2-ylidene)thieno[3,2-b]thiophen-2-ylidene]thieno[3,2-b]thiophen-5-ylidene]propanenitrile |
| SMILES | [H]/N=C/C(C#N)=c1/cc2s/c(=c3\cc4s/c(=C5\Sc6c(C)c(C)c(C)c(C)c6N5C)cc4s3)cc2s1 |
| InChI | InChI=1S/C27H21N3S5/c1-12-13(2)15(4)26-25(14(12)3)30(5)27(35-26)24-9-23-22(34-24)8-21(33-23)20-7-19-18(32-20)6-17(31-19)16(10-28)11-29/h6-10,28H,1-5H3/b17-16+,21-20+,27-24-,28-10+ |
| InChIKey | JJNGVXFHDFZXHI-YRUOCOPVSA-N |
| XLogP | 7.39 |
| TPSA | 50.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|