C25H23N3S — CID 122486085
(2E)-2-[(6E)-6-(4,5-diethyl-3-methyl-1,3-thiazol-2-ylidene)anthracen-2-ylidene]-3-iminopropanenitrile (PubChem CID 122486085) has the molecular formula C25H23N3S and a molecular weight of 397.55 g/mol. Its IUPAC name is (2E)-2-[(6E)-6-(4,5-diethyl-3-methyl-1,3-thiazol-2-ylidene)anthracen-2-ylidene]-3-iminopropanenitrile.
| Compound Name | (2E)-2-[(6E)-6-(4,5-diethyl-3-methyl-1,3-thiazol-2-ylidene)anthracen-2-ylidene]-3-iminopropanenitrile |
|---|---|
| PubChem CID | 122486085 |
| Molecular Formula | C25H23N3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (2E)-2-[(6E)-6-(4,5-diethyl-3-methyl-1,3-thiazol-2-ylidene)anthracen-2-ylidene]-3-iminopropanenitrile |
| SMILES | [H]/N=C/C(C#N)=c1/ccc2cc3c/c(=C4/SC(CC)=C(CC)N4C)ccc3cc2c1 |
| InChI | InChI=1S/C25H23N3S/c1-4-23-24(5-2)29-25(28(23)3)19-9-8-17-10-20-12-18(22(14-26)15-27)7-6-16(20)11-21(17)13-19/h6-14,26H,4-5H2,1-3H3/b22-18+,25-19+,26-14+ |
| InChIKey | PLHLZYGQWMPAML-BCRWONRRSA-N |
| XLogP | 5.09 |
| TPSA | 50.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|