C18H24N2O4 — CID 122486092
(5R)-4-(1,3-dimethylcyclobutanecarbonyl)-N-hydroxy-5-methyl-3,5-dihydro-2H-1,4-benzoxazepine-7-carboxamide (PubChem CID 122486092) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (5R)-4-(1,3-dimethylcyclobutanecarbonyl)-N-hydroxy-5-methyl-3,5-dihydro-2H-1,4-benzoxazepine-7-carboxamide.
| Compound Name | (5R)-4-(1,3-dimethylcyclobutanecarbonyl)-N-hydroxy-5-methyl-3,5-dihydro-2H-1,4-benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 122486092 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (5R)-4-(1,3-dimethylcyclobutanecarbonyl)-N-hydroxy-5-methyl-3,5-dihydro-2H-1,4-benzoxazepine-7-carboxamide |
| SMILES | CC1CC(C)(C(=O)N2CCOc3ccc(C(=O)NO)cc3[C@H]2C)C1 |
| InChI | InChI=1S/C18H24N2O4/c1-11-9-18(3,10-11)17(22)20-6-7-24-15-5-4-13(16(21)19-23)8-14(15)12(20)2/h4-5,8,11-12,23H,6-7,9-10H2,1-3H3,(H,19,21)/t11?,12-,18?/m1/s1 |
| InChIKey | OPTWVRONAWNFGH-BJCXPLBRSA-N |
| XLogP | 2.52 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|