C27H17N3O2S — CID 122486283
5-benzo[h]quinolin-5-yl-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide (PubChem CID 122486283) has the molecular formula C27H17N3O2S and a molecular weight of 447.52 g/mol. Its IUPAC name is 5-benzo[h]quinolin-5-yl-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide.
| Compound Name | 5-benzo[h]quinolin-5-yl-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486283 |
| Molecular Formula | C27H17N3O2S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 5-benzo[h]quinolin-5-yl-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide |
| SMILES | Cc1nc2cccc3c2n1-c1ccc(-c2cc4ccccc4c4ncccc24)cc1S3(=O)=O |
| InChI | InChI=1S/C27H17N3O2S/c1-16-29-22-9-4-10-24-27(22)30(16)23-12-11-18(15-25(23)33(24,31)32)21-14-17-6-2-3-7-19(17)26-20(21)8-5-13-28-26/h2-15H,1H3 |
| InChIKey | PKFXYRACMFSVNW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|