C33H22N4O2S — CID 122486639
15-ethyl-11-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide (PubChem CID 122486639) has the molecular formula C33H22N4O2S and a molecular weight of 538.63 g/mol. Its IUPAC name is 15-ethyl-11-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide.
| Compound Name | 15-ethyl-11-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486639 |
| Molecular Formula | C33H22N4O2S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 15-ethyl-11-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide |
| SMILES | CCc1nc2cc(-c3ccc(-c4ccc5ccc6cccnc6c5n4)cc3)cc3c2n1-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C33H22N4O2S/c1-2-30-35-26-18-24(19-29-33(26)37(30)27-7-3-4-8-28(27)40(29,38)39)20-9-11-21(12-10-20)25-16-15-23-14-13-22-6-5-17-34-31(22)32(23)36-25/h3-19H,2H2,1H3 |
| InChIKey | GDGWQVDINZTMLM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|