C35H26N4O2S — CID 122486653
15-tert-butyl-12-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide (PubChem CID 122486653) has the molecular formula C35H26N4O2S and a molecular weight of 566.69 g/mol. Its IUPAC name is 15-tert-butyl-12-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide.
| Compound Name | 15-tert-butyl-12-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486653 |
| Molecular Formula | C35H26N4O2S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 15-tert-butyl-12-[4-(1,10-phenanthrolin-2-yl)phenyl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide |
| SMILES | CC(C)(C)c1nc2c(-c3ccc(-c4ccc5ccc6cccnc6c5n4)cc3)ccc3c2n1-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C35H26N4O2S/c1-35(2,3)34-38-32-25(17-19-29-33(32)39(34)27-8-4-5-9-28(27)42(29,40)41)21-10-12-22(13-11-21)26-18-16-24-15-14-23-7-6-20-36-30(23)31(24)37-26/h4-20H,1-3H3 |
| InChIKey | IWJFALGQKUCMAI-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|