About 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate
1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 122487333) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate |
| PubChem CID | 122487333 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | C=C1CC(OC(=O)/C=C/C(=O)OC(C)C)C(=O)N1 |
| InChI | InChI=1S/C12H15NO5/c1-7(2)17-10(14)4-5-11(15)18-9-6-8(3)13-12(9)16/h4-5,7,9H,3,6H2,1-2H3,(H,13,16)/b5-4+ |
| InChIKey | RXGIBSKCUXXTKB-SNAWJCMRSA-N |
| XLogP | 0.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate?
The IUPAC name of 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate (CID 122487333) is 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate.
What is the SMILES notation for 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate?
The canonical SMILES for 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate is C=C1CC(OC(=O)/C=C/C(=O)OC(C)C)C(=O)N1.
What is the InChIKey of 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate?
The InChIKey is RXGIBSKCUXXTKB-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H15NO5/c1-7(2)17-10(14)4-5-11(15)18-9-6-8(3)13-12(9)16/h4-5,7,9H,3,6H2,1-2H3,(H,13,16)/b5-4+.
What are the key properties of 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate?
1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate has a molecular weight of 253.25 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-propan-2-yl (E)-but-2-enedioate is sourced from PubChem (CID 122487333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).