C37H24N4 — CID 122487429
2-phenyl-4-[4-(4-phenylquinazolin-2-yl)phenyl]-5H-indeno[1,2-d]pyrimidine (PubChem CID 122487429) has the molecular formula C37H24N4 and a molecular weight of 524.63 g/mol. Its IUPAC name is 2-phenyl-4-[4-(4-phenylquinazolin-2-yl)phenyl]-5H-indeno[1,2-d]pyrimidine.
| Compound Name | 2-phenyl-4-[4-(4-phenylquinazolin-2-yl)phenyl]-5H-indeno[1,2-d]pyrimidine |
|---|---|
| PubChem CID | 122487429 |
| Molecular Formula | C37H24N4 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-phenyl-4-[4-(4-phenylquinazolin-2-yl)phenyl]-5H-indeno[1,2-d]pyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4nc(-c5ccccc5)c5ccccc5n4)cc3)c3c(n2)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C37H24N4/c1-3-11-24(12-4-1)33-30-17-9-10-18-32(30)38-36(39-33)27-21-19-25(20-22-27)34-31-23-28-15-7-8-16-29(28)35(31)41-37(40-34)26-13-5-2-6-14-26/h1-22H,23H2 |
| InChIKey | LDYYUQLELDWKJX-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |