C81H84N6 — CID 122487672
2,4,6-tris[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine (PubChem CID 122487672) has the molecular formula C81H84N6 and a molecular weight of 1141.61 g/mol. Its IUPAC name is 2,4,6-tris[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 122487672 |
| Molecular Formula | C81H84N6 |
| Molecular Weight | 1141.61 g/mol |
| Exact Mass | 1140.68 |
| IUPAC Name | 2,4,6-tris[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccc(-c3ccc(-c4ccccc4-c4nc(-c5ccccc5-c5ccc(-c6ccc7c(c6)C(C)(C)C(C)(C)C7(C)C)nc5)nc(-c5ccccc5-c5ccc(-c6ccc7c(c6)C(C)(C)C(C)(C)C7(C)C)nc5)n4)cn3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C81H84N6/c1-73(2)61-37-31-49(43-64(61)76(7,8)79(73,13)14)67-40-34-52(46-82-67)55-25-19-22-28-58(55)70-85-71(59-29-23-20-26-56(59)53-35-41-68(83-47-53)50-32-38-62-65(44-50)77(9,10)80(15,16)74(62,3)4)87-72(86-70)60-30-24-21-27-57(60)54-36-42-69(84-48-54)51-33-39-63-66(45-51)78(11,12)81(17,18)75(63,5)6/h19-48H,1-18H3 |
| InChIKey | VASQJOMDSHMJNY-UHFFFAOYSA-N |
| XLogP | 20.84 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1141.61 |
| LogP ≤ 5 | 20.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |