C27H32FN7O2 — CID 122488109
N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-(triazol-1-yl)benzamide (PubChem CID 122488109) has the molecular formula C27H32FN7O2 and a molecular weight of 505.60 g/mol. Its IUPAC name is N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-(triazol-1-yl)benzamide.
| Compound Name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-(triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122488109 |
| Molecular Formula | C27H32FN7O2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-(triazol-1-yl)benzamide |
| SMILES | O=C(N[C@@H](CCCN[C@@H]1C[C@H]1c1ccc(F)cc1)C(=O)N1CCNCC1)c1ccc(-n2ccnn2)cc1 |
| InChI | InChI=1S/C27H32FN7O2/c28-21-7-3-19(4-8-21)23-18-25(23)30-11-1-2-24(27(37)34-15-12-29-13-16-34)32-26(36)20-5-9-22(10-6-20)35-17-14-31-33-35/h3-10,14,17,23-25,29-30H,1-2,11-13,15-16,18H2,(H,32,36)/t23-,24-,25+/m0/s1 |
| InChIKey | PCKOGDBVVLMPMD-CCDWMCETSA-N |
| XLogP | 1.86 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|