C17H21Cl2N7 — CID 122489224
1-(3,4-dichlorophenyl)-2-[4-methyl-6-[[(3S)-piperidin-3-yl]amino]pyrimidin-2-yl]guanidine (PubChem CID 122489224) has the molecular formula C17H21Cl2N7 and a molecular weight of 394.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[4-methyl-6-[[(3S)-piperidin-3-yl]amino]pyrimidin-2-yl]guanidine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[4-methyl-6-[[(3S)-piperidin-3-yl]amino]pyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 122489224 |
| Molecular Formula | C17H21Cl2N7 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[4-methyl-6-[[(3S)-piperidin-3-yl]amino]pyrimidin-2-yl]guanidine |
| SMILES | Cc1cc(N[C@H]2CCCNC2)nc(/N=C(\N)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H21Cl2N7/c1-10-7-15(23-12-3-2-6-21-9-12)25-17(22-10)26-16(20)24-11-4-5-13(18)14(19)8-11/h4-5,7-8,12,21H,2-3,6,9H2,1H3,(H4,20,22,23,24,25,26)/t12-/m0/s1 |
| InChIKey | IZLWEVLGOFKZLH-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|