About N,2-dimethylpropan-1-amine
N,2-dimethylpropan-1-amine (PubChem CID 12249) has the molecular formula C5H13N
and a molecular weight of 87.17 g/mol. Its IUPAC name is N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N,2-dimethylpropan-1-amine |
| PubChem CID | 12249 |
| Molecular Formula | C5H13N |
| Molecular Weight | 87.17 g/mol |
| Exact Mass | 87.10 |
| IUPAC Name | N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)C |
| InChI | InChI=1S/C5H13N/c1-5(2)4-6-3/h5-6H,4H2,1-3H3 |
| InChIKey | QKYWADPCTHTJHQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylpropan-1-amine?
The IUPAC name of N,2-dimethylpropan-1-amine (CID 12249) is N,2-dimethylpropan-1-amine.
What is the SMILES notation for N,2-dimethylpropan-1-amine?
The canonical SMILES for N,2-dimethylpropan-1-amine is CNCC(C)C.
What is the InChIKey of N,2-dimethylpropan-1-amine?
The InChIKey is QKYWADPCTHTJHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N/c1-5(2)4-6-3/h5-6H,4H2,1-3H3.
What are the key properties of N,2-dimethylpropan-1-amine?
N,2-dimethylpropan-1-amine has a molecular weight of 87.17 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylpropan-1-amine is sourced from PubChem (CID 12249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).