C12H13F3O — CID 122490390
3,3-diethynyl-1,1,1-trifluoro-4,4-dimethylhexan-2-one (PubChem CID 122490390) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is 3,3-diethynyl-1,1,1-trifluoro-4,4-dimethylhexan-2-one.
| Compound Name | 3,3-diethynyl-1,1,1-trifluoro-4,4-dimethylhexan-2-one |
|---|---|
| PubChem CID | 122490390 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3,3-diethynyl-1,1,1-trifluoro-4,4-dimethylhexan-2-one |
| SMILES | C#CC(C#C)(C(=O)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C12H13F3O/c1-6-10(4,5)11(7-2,8-3)9(16)12(13,14)15/h2-3H,6H2,1,4-5H3 |
| InChIKey | XGETUIFKBKYIPL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|