About N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide
N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide (PubChem CID 122490408) has the molecular formula C16H30N2O3
and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide |
| PubChem CID | 122490408 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide |
| SMILES | C=C(OCC)[C@H](CCN1CCOCC1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-6-21-13(2)14(17-15(19)16(3,4)5)7-8-18-9-11-20-12-10-18/h14H,2,6-12H2,1,3-5H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | SGKKEPOMCVCTOW-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide (CID 122490408) is N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide is C=C(OCC)[C@H](CCN1CCOCC1)NC(=O)C(C)(C)C.
What is the InChIKey of N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide?
The InChIKey is SGKKEPOMCVCTOW-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H30N2O3/c1-6-21-13(2)14(17-15(19)16(3,4)5)7-8-18-9-11-20-12-10-18/h14H,2,6-12H2,1,3-5H3,(H,17,19)/t14-/m0/s1.
What are the key properties of N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide?
N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide has a molecular weight of 298.43 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2-ethoxy-5-morpholin-4-ylpent-1-en-3-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 122490408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).