C40H25N5O2 — CID 122491309
1,4-diphenyl-9-(9-phenylcarbazol-3-yl)pyrazino[2,3-f]quinoxaline-2,3-dione (PubChem CID 122491309) has the molecular formula C40H25N5O2 and a molecular weight of 607.67 g/mol. Its IUPAC name is 1,4-diphenyl-9-(9-phenylcarbazol-3-yl)pyrazino[2,3-f]quinoxaline-2,3-dione.
| Compound Name | 1,4-diphenyl-9-(9-phenylcarbazol-3-yl)pyrazino[2,3-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 122491309 |
| Molecular Formula | C40H25N5O2 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 1,4-diphenyl-9-(9-phenylcarbazol-3-yl)pyrazino[2,3-f]quinoxaline-2,3-dione |
| SMILES | O=c1c(=O)n(-c2ccccc2)c2c3nc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cnc3ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C40H25N5O2/c46-39-40(47)45(29-16-8-3-9-17-29)38-36(44(39)28-14-6-2-7-15-28)23-21-32-37(38)42-33(25-41-32)26-20-22-35-31(24-26)30-18-10-11-19-34(30)43(35)27-12-4-1-5-13-27/h1-25H |
| InChIKey | ZJFDCYSQXDMROI-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|