C41H29N3O2 — CID 122491611
6-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-1,3-diphenylquinazoline-2,4-dione (PubChem CID 122491611) has the molecular formula C41H29N3O2 and a molecular weight of 595.70 g/mol. Its IUPAC name is 6-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-1,3-diphenylquinazoline-2,4-dione.
| Compound Name | 6-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-1,3-diphenylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 122491611 |
| Molecular Formula | C41H29N3O2 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 6-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-1,3-diphenylquinazoline-2,4-dione |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4ccc5c(c4)c(=O)n(-c4ccccc4)c(=O)n5-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C41H29N3O2/c1-41(2)34-19-11-9-17-29(34)31-24-32-30-18-10-12-20-36(30)42(38(32)25-35(31)41)28-21-22-37-33(23-28)39(45)44(27-15-7-4-8-16-27)40(46)43(37)26-13-5-3-6-14-26/h3-25H,1-2H3 |
| InChIKey | VKMSXLZDOXQAHY-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |