About N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide
N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide (PubChem CID 122491621) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide |
| PubChem CID | 122491621 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide |
| SMILES | COCC(C)(C)CN1CC2C(CNC(C)=O)[C@H]2C1 |
| InChI | InChI=1S/C14H26N2O2/c1-10(17)15-5-11-12-6-16(7-13(11)12)8-14(2,3)9-18-4/h11-13H,5-9H2,1-4H3,(H,15,17)/t11?,12-,13?/m1/s1 |
| InChIKey | AKBSRHLJZBTLOZ-OTTFEQOBSA-N |
| XLogP | 0.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide?
The IUPAC name of N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide (CID 122491621) is N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide.
What is the SMILES notation for N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide?
The canonical SMILES for N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide is COCC(C)(C)CN1CC2C(CNC(C)=O)[C@H]2C1.
What is the InChIKey of N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide?
The InChIKey is AKBSRHLJZBTLOZ-OTTFEQOBSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-10(17)15-5-11-12-6-16(7-13(11)12)8-14(2,3)9-18-4/h11-13H,5-9H2,1-4H3,(H,15,17)/t11?,12-,13?/m1/s1.
What are the key properties of N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide?
N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide has a molecular weight of 254.37 g/mol, XLogP of 0.97, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(5R)-3-(3-methoxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]acetamide is sourced from PubChem (CID 122491621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).