C40H24N4O5 — CID 122491684
1-[9-(2,4-dioxo-3-phenylquinazolin-1-yl)dibenzofuran-2-yl]-3-phenylquinazoline-2,4-dione (PubChem CID 122491684) has the molecular formula C40H24N4O5 and a molecular weight of 640.66 g/mol. Its IUPAC name is 1-[9-(2,4-dioxo-3-phenylquinazolin-1-yl)dibenzofuran-2-yl]-3-phenylquinazoline-2,4-dione.
| Compound Name | 1-[9-(2,4-dioxo-3-phenylquinazolin-1-yl)dibenzofuran-2-yl]-3-phenylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 122491684 |
| Molecular Formula | C40H24N4O5 |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | 1-[9-(2,4-dioxo-3-phenylquinazolin-1-yl)dibenzofuran-2-yl]-3-phenylquinazoline-2,4-dione |
| SMILES | O=c1c2ccccc2n(-c2ccc3oc4cccc(-n5c(=O)n(-c6ccccc6)c(=O)c6ccccc65)c4c3c2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C40H24N4O5/c45-37-28-16-7-9-18-31(28)41(39(47)42(37)25-12-3-1-4-13-25)27-22-23-34-30(24-27)36-33(20-11-21-35(36)49-34)44-32-19-10-8-17-29(32)38(46)43(40(44)48)26-14-5-2-6-15-26/h1-24H |
| InChIKey | RYIGRCKWDRSWJO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 101.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |