C52H34N2O2 — CID 122491707
1,3-bis(3,5-diphenylphenyl)phenanthro[9,10-d]pyrimidine-2,4-dione (PubChem CID 122491707) has the molecular formula C52H34N2O2 and a molecular weight of 718.86 g/mol. Its IUPAC name is 1,3-bis(3,5-diphenylphenyl)phenanthro[9,10-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-bis(3,5-diphenylphenyl)phenanthro[9,10-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122491707 |
| Molecular Formula | C52H34N2O2 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.26 |
| IUPAC Name | 1,3-bis(3,5-diphenylphenyl)phenanthro[9,10-d]pyrimidine-2,4-dione |
| SMILES | O=c1c2c3ccccc3c3ccccc3c2n(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c(=O)n1-c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C52H34N2O2/c55-51-49-47-27-15-13-25-45(47)46-26-14-16-28-48(46)50(49)53(43-31-39(35-17-5-1-6-18-35)29-40(32-43)36-19-7-2-8-20-36)52(56)54(51)44-33-41(37-21-9-3-10-22-37)30-42(34-44)38-23-11-4-12-24-38/h1-34H |
| InChIKey | DDJBOISBZPLHDI-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|