C42H28N4O2 — CID 122491742
6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,3-diphenylquinazoline-2,4-dione (PubChem CID 122491742) has the molecular formula C42H28N4O2 and a molecular weight of 620.71 g/mol. Its IUPAC name is 6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,3-diphenylquinazoline-2,4-dione.
| Compound Name | 6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,3-diphenylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 122491742 |
| Molecular Formula | C42H28N4O2 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,3-diphenylquinazoline-2,4-dione |
| SMILES | O=c1c2cc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)ccc2n(-c2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C42H28N4O2/c47-41-36-27-32(24-25-39(36)45(34-20-9-3-10-21-34)42(48)46(41)35-22-11-4-12-23-35)31-18-13-19-33(26-31)40-43-37(29-14-5-1-6-15-29)28-38(44-40)30-16-7-2-8-17-30/h1-28H |
| InChIKey | KXFIIPKCPZQLGM-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |