About 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole
2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole (PubChem CID 122492369) has the molecular formula C35H30N2
and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole.
Molecular Properties
| Compound Name | 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole |
| PubChem CID | 122492369 |
| Molecular Formula | C35H30N2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole |
| SMILES | Cc1cc(-c2ccc3c(c2)[nH]c2c(C)cc(C)cc23)cc(-c2ccc3c4cc(C)ccc4n(C)c3c2)c1 |
| InChI | InChI=1S/C35H30N2/c1-20-6-11-33-30(15-20)29-10-8-25(19-34(29)37(33)5)27-14-22(3)13-26(17-27)24-7-9-28-31-16-21(2)12-23(4)35(31)36-32(28)18-24/h6-19,36H,1-5H3 |
| InChIKey | PMWARCDMMKROFD-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole?
The IUPAC name of 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole (CID 122492369) is 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole.
What is the SMILES notation for 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole?
The canonical SMILES for 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole is Cc1cc(-c2ccc3c(c2)[nH]c2c(C)cc(C)cc23)cc(-c2ccc3c4cc(C)ccc4n(C)c3c2)c1.
What is the InChIKey of 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole?
The InChIKey is PMWARCDMMKROFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H30N2/c1-20-6-11-33-30(15-20)29-10-8-25(19-34(29)37(33)5)27-14-22(3)13-26(17-27)24-7-9-28-31-16-21(2)12-23(4)35(31)36-32(28)18-24/h6-19,36H,1-5H3.
What are the key properties of 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole?
2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole has a molecular weight of 478.64 g/mol, XLogP of 9.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(6,8-dimethyl-9H-carbazol-2-yl)-5-methylphenyl]-6,9-dimethylcarbazole is sourced from PubChem (CID 122492369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).