About 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol
4,6-dimethyl-1,2-dihydropyrimidine-2-thiol (PubChem CID 122493325) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol.
Molecular Properties
| Compound Name | 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol |
| PubChem CID | 122493325 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol |
| SMILES | CC1=CC(C)=NC(S)N1 |
| InChI | InChI=1S/C6H10N2S/c1-4-3-5(2)8-6(9)7-4/h3,6-7,9H,1-2H3 |
| InChIKey | VOODFXPPZGKFOK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol?
The IUPAC name of 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol (CID 122493325) is 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol.
What is the SMILES notation for 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol?
The canonical SMILES for 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol is CC1=CC(C)=NC(S)N1.
What is the InChIKey of 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol?
The InChIKey is VOODFXPPZGKFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-4-3-5(2)8-6(9)7-4/h3,6-7,9H,1-2H3.
What are the key properties of 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol?
4,6-dimethyl-1,2-dihydropyrimidine-2-thiol has a molecular weight of 142.23 g/mol, XLogP of 1.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1,2-dihydropyrimidine-2-thiol is sourced from PubChem (CID 122493325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).