About 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol
5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol (PubChem CID 122493496) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol.
Molecular Properties
| Compound Name | 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol |
| PubChem CID | 122493496 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol |
| SMILES | CC(C)=CCC1C(O)C=CC(O)C1S |
| InChI | InChI=1S/C11H18O2S/c1-7(2)3-4-8-9(12)5-6-10(13)11(8)14/h3,5-6,8-14H,4H2,1-2H3 |
| InChIKey | QQVGSOQNVUEHTI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol?
The IUPAC name of 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol (CID 122493496) is 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol.
What is the SMILES notation for 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol?
The canonical SMILES for 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol is CC(C)=CCC1C(O)C=CC(O)C1S.
What is the InChIKey of 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol?
The InChIKey is QQVGSOQNVUEHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2S/c1-7(2)3-4-8-9(12)5-6-10(13)11(8)14/h3,5-6,8-14H,4H2,1-2H3.
What are the key properties of 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol?
5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol has a molecular weight of 214.33 g/mol, XLogP of 1.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylbut-2-enyl)-6-sulfanylcyclohex-2-ene-1,4-diol is sourced from PubChem (CID 122493496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).