C17H25NO8S — CID 122493868
[(3S,4S,6S)-5-acetamido-4-hydroxy-6-(4-methoxyphenoxy)-3-methyloxan-2-yl]methyl methanesulfonate (PubChem CID 122493868) has the molecular formula C17H25NO8S and a molecular weight of 403.45 g/mol. Its IUPAC name is [(3S,4S,6S)-5-acetamido-4-hydroxy-6-(4-methoxyphenoxy)-3-methyloxan-2-yl]methyl methanesulfonate.
| Compound Name | [(3S,4S,6S)-5-acetamido-4-hydroxy-6-(4-methoxyphenoxy)-3-methyloxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 122493868 |
| Molecular Formula | C17H25NO8S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [(3S,4S,6S)-5-acetamido-4-hydroxy-6-(4-methoxyphenoxy)-3-methyloxan-2-yl]methyl methanesulfonate |
| SMILES | COc1ccc(O[C@@H]2OC(COS(C)(=O)=O)[C@@H](C)[C@H](O)C2NC(C)=O)cc1 |
| InChI | InChI=1S/C17H25NO8S/c1-10-14(9-24-27(4,21)22)26-17(15(16(10)20)18-11(2)19)25-13-7-5-12(23-3)6-8-13/h5-8,10,14-17,20H,9H2,1-4H3,(H,18,19)/t10-,14?,15?,16+,17-/m1/s1 |
| InChIKey | LDJZCABRGNQWLP-XGLQMQBXSA-N |
| XLogP | 0.28 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|