About (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol
(5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol (PubChem CID 122493889) has the molecular formula C11H21OP
and a molecular weight of 200.26 g/mol. Its IUPAC name is (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 122493889 |
| Molecular Formula | C11H21OP |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol |
| SMILES | CP1C2(C)CCC[C@@]1(C)CC(O)C2 |
| InChI | InChI=1S/C11H21OP/c1-10-5-4-6-11(2,13(10)3)8-9(12)7-10/h9,12H,4-8H2,1-3H3/t9?,10-,11?,13?/m0/s1 |
| InChIKey | ACOYEAVYKHWECG-CIYITXRRSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol (CID 122493889) is (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol is CP1C2(C)CCC[C@@]1(C)CC(O)C2.
What is the InChIKey of (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol?
The InChIKey is ACOYEAVYKHWECG-CIYITXRRSA-N. The full InChI is InChI=1S/C11H21OP/c1-10-5-4-6-11(2,13(10)3)8-9(12)7-10/h9,12H,4-8H2,1-3H3/t9?,10-,11?,13?/m0/s1.
What are the key properties of (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol?
(5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol has a molecular weight of 200.26 g/mol, XLogP of 2.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1,5,9-trimethyl-9-phosphabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 122493889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).