C12H22IO2P — CID 122493902
9-iodo-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane (PubChem CID 122493902) has the molecular formula C12H22IO2P and a molecular weight of 356.18 g/mol. Its IUPAC name is 9-iodo-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane.
| Compound Name | 9-iodo-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 122493902 |
| Molecular Formula | C12H22IO2P |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 9-iodo-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
| SMILES | CC1(C)CC2(CC(C)(C)P1I)OCCCO2 |
| InChI | InChI=1S/C12H22IO2P/c1-10(2)8-12(14-6-5-7-15-12)9-11(3,4)16(10)13/h5-9H2,1-4H3 |
| InChIKey | YEAVBLBOBJPEIG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|