C12H15F2NO — CID 122493935
(1R)-1-[(1R)-3,4-dihydro-1H-isochromen-1-yl]-2-fluoro-N-(fluoromethyl)ethanamine (PubChem CID 122493935) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is (1R)-1-[(1R)-3,4-dihydro-1H-isochromen-1-yl]-2-fluoro-N-(fluoromethyl)ethanamine.
| Compound Name | (1R)-1-[(1R)-3,4-dihydro-1H-isochromen-1-yl]-2-fluoro-N-(fluoromethyl)ethanamine |
|---|---|
| PubChem CID | 122493935 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1R)-1-[(1R)-3,4-dihydro-1H-isochromen-1-yl]-2-fluoro-N-(fluoromethyl)ethanamine |
| SMILES | FCN[C@@H](CF)[C@@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C12H15F2NO/c13-7-11(15-8-14)12-10-4-2-1-3-9(10)5-6-16-12/h1-4,11-12,15H,5-8H2/t11-,12+/m0/s1 |
| InChIKey | HLOHRETVYJOHLQ-NWDGAFQWSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|