C14H15N5O — CID 122494010
7-(4-aminocyclohexa-1,5-dien-1-yl)-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine (PubChem CID 122494010) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 7-(4-aminocyclohexa-1,5-dien-1-yl)-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine.
| Compound Name | 7-(4-aminocyclohexa-1,5-dien-1-yl)-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine |
|---|---|
| PubChem CID | 122494010 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 7-(4-aminocyclohexa-1,5-dien-1-yl)-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine |
| SMILES | Nc1ncnc2c3c(n(C4=CCC(N)C=C4)c12)COC3 |
| InChI | InChI=1S/C14H15N5O/c15-8-1-3-9(4-2-8)19-11-6-20-5-10(11)12-13(19)14(16)18-7-17-12/h1,3-4,7-8H,2,5-6,15H2,(H2,16,17,18) |
| InChIKey | PKPJFFGBECSEAF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |