About 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide
4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide (PubChem CID 122494149) has the molecular formula C30H31Cl2NO4
and a molecular weight of 540.49 g/mol. Its IUPAC name is 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide.
Molecular Properties
| Compound Name | 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide |
| PubChem CID | 122494149 |
| Molecular Formula | C30H31Cl2NO4 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C30H31Cl2NO4/c1-3-5-7-13-33(14-8-6-4-2)30(36)20-11-9-19(10-12-20)29-21-15-23(31)25(34)17-27(21)37-28-18-26(35)24(32)16-22(28)29/h9-12,15-18,34H,3-8,13-14H2,1-2H3 |
| InChIKey | KZZRULVYSZPXFB-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide?
The IUPAC name of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide (CID 122494149) is 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide.
What is the SMILES notation for 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide?
The canonical SMILES for 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide is CCCCCN(CCCCC)C(=O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1.
What is the InChIKey of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide?
The InChIKey is KZZRULVYSZPXFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31Cl2NO4/c1-3-5-7-13-33(14-8-6-4-2)30(36)20-11-9-19(10-12-20)29-21-15-23(31)25(34)17-27(21)37-28-18-26(35)24(32)16-22(28)29/h9-12,15-18,34H,3-8,13-14H2,1-2H3.
What are the key properties of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide?
4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide has a molecular weight of 540.49 g/mol, XLogP of 8.40, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N,N-dipentylbenzamide is sourced from PubChem (CID 122494149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).