C19H26FN — CID 122494798
(3R)-2-cyclopropyl-4-[(4R)-4-fluorocyclohexen-1-yl]-3-methyl-1,2,3,7,8,8a-hexahydroquinoline (PubChem CID 122494798) has the molecular formula C19H26FN and a molecular weight of 287.42 g/mol. Its IUPAC name is (3R)-2-cyclopropyl-4-[(4R)-4-fluorocyclohexen-1-yl]-3-methyl-1,2,3,7,8,8a-hexahydroquinoline.
| Compound Name | (3R)-2-cyclopropyl-4-[(4R)-4-fluorocyclohexen-1-yl]-3-methyl-1,2,3,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 122494798 |
| Molecular Formula | C19H26FN |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (3R)-2-cyclopropyl-4-[(4R)-4-fluorocyclohexen-1-yl]-3-methyl-1,2,3,7,8,8a-hexahydroquinoline |
| SMILES | C[C@@H]1C(C2=CC[C@H](F)CC2)=C2C=CCCC2NC1C1CC1 |
| InChI | InChI=1S/C19H26FN/c1-12-18(13-8-10-15(20)11-9-13)16-4-2-3-5-17(16)21-19(12)14-6-7-14/h2,4,8,12,14-15,17,19,21H,3,5-7,9-11H2,1H3/t12-,15+,17?,19?/m1/s1 |
| InChIKey | NCYDAJBSHDNAAN-UNGXXHGWSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |