C13H23NO8 — CID 122495909
(3R,4R,5S,6R)-N-(1,3-dioxolan-2-ylmethyl)-4,5-dihydroxy-3,6-dimethoxy-N-methyloxane-2-carboxamide (PubChem CID 122495909) has the molecular formula C13H23NO8 and a molecular weight of 321.33 g/mol. Its IUPAC name is (3R,4R,5S,6R)-N-(1,3-dioxolan-2-ylmethyl)-4,5-dihydroxy-3,6-dimethoxy-N-methyloxane-2-carboxamide.
| Compound Name | (3R,4R,5S,6R)-N-(1,3-dioxolan-2-ylmethyl)-4,5-dihydroxy-3,6-dimethoxy-N-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 122495909 |
| Molecular Formula | C13H23NO8 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3R,4R,5S,6R)-N-(1,3-dioxolan-2-ylmethyl)-4,5-dihydroxy-3,6-dimethoxy-N-methyloxane-2-carboxamide |
| SMILES | CO[C@@H]1OC(C(=O)N(C)CC2OCCO2)[C@H](OC)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO8/c1-14(6-7-20-4-5-21-7)12(17)11-10(18-2)8(15)9(16)13(19-3)22-11/h7-11,13,15-16H,4-6H2,1-3H3/t8-,9+,10-,11?,13-/m1/s1 |
| InChIKey | PGZAIJRKDMWVMN-NSVQFTCYSA-N |
| XLogP | -2.07 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |