C24H19Cl2FN4OS — CID 122495991
6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 122495991) has the molecular formula C24H19Cl2FN4OS and a molecular weight of 501.41 g/mol. Its IUPAC name is 6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine].
| Compound Name | 6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] |
|---|---|
| PubChem CID | 122495991 |
| Molecular Formula | C24H19Cl2FN4OS |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | CC1(c2cc(Cl)c(F)c(Cl)c2)CC(c2ccc3c(c2)COC32CN(c3ncccn3)C2)=NS1 |
| InChI | InChI=1S/C24H19Cl2FN4OS/c1-23(16-8-18(25)21(27)19(26)9-16)10-20(30-33-23)14-3-4-17-15(7-14)11-32-24(17)12-31(13-24)22-28-5-2-6-29-22/h2-9H,10-13H2,1H3 |
| InChIKey | UQPFIGCWTGJKHU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|