C9H9N5O5 — CID 122496146
[3-ethyl-5-(isocyanatomethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl cyanate (PubChem CID 122496146) has the molecular formula C9H9N5O5 and a molecular weight of 267.20 g/mol. Its IUPAC name is [3-ethyl-5-(isocyanatomethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl cyanate.
| Compound Name | [3-ethyl-5-(isocyanatomethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl cyanate |
|---|---|
| PubChem CID | 122496146 |
| Molecular Formula | C9H9N5O5 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | [3-ethyl-5-(isocyanatomethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl cyanate |
| SMILES | CCn1c(=O)n(CN=C=O)c(=O)n(COC#N)c1=O |
| InChI | InChI=1S/C9H9N5O5/c1-2-12-7(16)13(4-11-5-15)9(18)14(8(12)17)6-19-3-10/h2,4,6H2,1H3 |
| InChIKey | JILWVAXWBJHFLW-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 128.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|