C27H25N3O — CID 122496296
(5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496296) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496296 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | Cc1nc2c(n1-c1ccc(-c3ccccc3)cc1)CC[C@H]1[C@H](C)C(=O)C(C#N)=C[C@]21C |
| InChI | InChI=1S/C27H25N3O/c1-17-23-13-14-24-26(27(23,3)15-21(16-28)25(17)31)29-18(2)30(24)22-11-9-20(10-12-22)19-7-5-4-6-8-19/h4-12,15,17,23H,13-14H2,1-3H3/t17-,23-,27-/m0/s1 |
| InChIKey | VSZQTPZCINZZBR-IPZQTHRPSA-N |
| XLogP | 5.34 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |