C24H23N5O — CID 122496297
(5aS,6S,9aR)-6,9a-dimethyl-2-(1-methylpyrazol-4-yl)-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496297) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is (5aS,6S,9aR)-6,9a-dimethyl-2-(1-methylpyrazol-4-yl)-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-6,9a-dimethyl-2-(1-methylpyrazol-4-yl)-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496297 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (5aS,6S,9aR)-6,9a-dimethyl-2-(1-methylpyrazol-4-yl)-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)c3nc(-c4cnn(C)c4)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C24H23N5O/c1-15-19-9-10-20-22(24(19,2)11-16(12-25)21(15)30)27-23(17-13-26-28(3)14-17)29(20)18-7-5-4-6-8-18/h4-8,11,13-15,19H,9-10H2,1-3H3/t15-,19-,24-/m0/s1 |
| InChIKey | MCHYPBDJVSZMBO-KFSOKAEPSA-N |
| XLogP | 3.76 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |