C21H23N3O2 — CID 122496301
(5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carboxamide (PubChem CID 122496301) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carboxamide.
| Compound Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carboxamide |
|---|---|
| PubChem CID | 122496301 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carboxamide |
| SMILES | Cc1nc2c(n1-c1ccccc1)CC[C@H]1[C@H](C)C(=O)C(C(N)=O)=C[C@]21C |
| InChI | InChI=1S/C21H23N3O2/c1-12-16-9-10-17-19(21(16,3)11-15(18(12)25)20(22)26)23-13(2)24(17)14-7-5-4-6-8-14/h4-8,11-12,16H,9-10H2,1-3H3,(H2,22,26)/t12-,16-,21-/m0/s1 |
| InChIKey | LJGYLPUWVHDNRT-SAZGQGMLSA-N |
| XLogP | 2.63 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|